About 1-benzyl-6,7-dihydro-5H-indazol-4-one
1-benzyl-6,7-dihydro-5H-indazol-4-one (PubChem CID 4738558) has the molecular formula C14H14N2O
and a molecular weight of 226.28 g/mol. Its IUPAC name is 1-benzyl-6,7-dihydro-5H-indazol-4-one.
Molecular Properties
| Compound Name | 1-benzyl-6,7-dihydro-5H-indazol-4-one |
| PubChem CID | 4738558 |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 1-benzyl-6,7-dihydro-5H-indazol-4-one |
| SMILES | O=C1CCCc2c1cnn2Cc1ccccc1 |
| InChI | InChI=1S/C14H14N2O/c17-14-8-4-7-13-12(14)9-15-16(13)10-11-5-2-1-3-6-11/h1-3,5-6,9H,4,7-8,10H2 |
| InChIKey | KZRACVAICNSDTK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-benzyl-6,7-dihydro-5H-indazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-6,7-dihydro-5H-indazol-4-one?
The IUPAC name of 1-benzyl-6,7-dihydro-5H-indazol-4-one (CID 4738558) is 1-benzyl-6,7-dihydro-5H-indazol-4-one.
What is the SMILES notation for 1-benzyl-6,7-dihydro-5H-indazol-4-one?
The canonical SMILES for 1-benzyl-6,7-dihydro-5H-indazol-4-one is O=C1CCCc2c1cnn2Cc1ccccc1.
What is the InChIKey of 1-benzyl-6,7-dihydro-5H-indazol-4-one?
The InChIKey is KZRACVAICNSDTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O/c17-14-8-4-7-13-12(14)9-15-16(13)10-11-5-2-1-3-6-11/h1-3,5-6,9H,4,7-8,10H2.
What are the key properties of 1-benzyl-6,7-dihydro-5H-indazol-4-one?
1-benzyl-6,7-dihydro-5H-indazol-4-one has a molecular weight of 226.28 g/mol, XLogP of 2.45, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-6,7-dihydro-5H-indazol-4-one is sourced from PubChem (CID 4738558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).