About 2-(2,5-dimethoxy-4-piperazin-1-ylsulfonylphenyl)isoindole-1,3-dione
2-(2,5-dimethoxy-4-piperazin-1-ylsulfonylphenyl)isoindole-1,3-dione (PubChem CID 4738898) has the molecular formula C20H21N3O6S
and a molecular weight of 431.47 g/mol. Its IUPAC name is 2-(2,5-dimethoxy-4-piperazin-1-ylsulfonylphenyl)isoindole-1,3-dione.
Molecular Properties
| Compound Name | 2-(2,5-dimethoxy-4-piperazin-1-ylsulfonylphenyl)isoindole-1,3-dione |
| PubChem CID | 4738898 |
| Molecular Formula | C20H21N3O6S |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 2-(2,5-dimethoxy-4-piperazin-1-ylsulfonylphenyl)isoindole-1,3-dione |
| SMILES | COc1cc(S(=O)(=O)N2CCNCC2)c(OC)cc1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H21N3O6S/c1-28-16-12-18(30(26,27)22-9-7-21-8-10-22)17(29-2)11-15(16)23-19(24)13-5-3-4-6-14(13)20(23)25/h3-6,11-12,21H,7-10H2,1-2H3 |
| InChIKey | PPYUCLMTMZPWPB-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dimethoxy-4-piperazin-1-ylsulfonylphenyl)isoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dimethoxy-4-piperazin-1-ylsulfonylphenyl)isoindole-1,3-dione?
The IUPAC name of 2-(2,5-dimethoxy-4-piperazin-1-ylsulfonylphenyl)isoindole-1,3-dione (CID 4738898) is 2-(2,5-dimethoxy-4-piperazin-1-ylsulfonylphenyl)isoindole-1,3-dione.
What is the SMILES notation for 2-(2,5-dimethoxy-4-piperazin-1-ylsulfonylphenyl)isoindole-1,3-dione?
The canonical SMILES for 2-(2,5-dimethoxy-4-piperazin-1-ylsulfonylphenyl)isoindole-1,3-dione is COc1cc(S(=O)(=O)N2CCNCC2)c(OC)cc1N1C(=O)c2ccccc2C1=O.
What is the InChIKey of 2-(2,5-dimethoxy-4-piperazin-1-ylsulfonylphenyl)isoindole-1,3-dione?
The InChIKey is PPYUCLMTMZPWPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N3O6S/c1-28-16-12-18(30(26,27)22-9-7-21-8-10-22)17(29-2)11-15(16)23-19(24)13-5-3-4-6-14(13)20(23)25/h3-6,11-12,21H,7-10H2,1-2H3.
What are the key properties of 2-(2,5-dimethoxy-4-piperazin-1-ylsulfonylphenyl)isoindole-1,3-dione?
2-(2,5-dimethoxy-4-piperazin-1-ylsulfonylphenyl)isoindole-1,3-dione has a molecular weight of 431.47 g/mol, XLogP of 1.10, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dimethoxy-4-piperazin-1-ylsulfonylphenyl)isoindole-1,3-dione is sourced from PubChem (CID 4738898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).