pyrido[2,3-b]pyrazine-6-carboxylic acid

C8H5N3O2 — CID 4739091

IUPACpyrido[2,3-b]pyrazine-6-carboxylic acid
SMILESO=C(O)c1ccc2nccnc2n1
InChIInChI=1S/C8H5N3O2/c12-8(13)6-2-1-5-7(11-6)10-4-3-9-5/h1-4H,(H,12,13)
InChIKeyHOBUKUYGYYLBAA-UHFFFAOYSA-N
MW175.15 g/mol
LogP0.72
Rot. Bonds1

About pyrido[2,3-b]pyrazine-6-carboxylic acid

pyrido[2,3-b]pyrazine-6-carboxylic acid (PubChem CID 4739091) has the molecular formula C8H5N3O2 and a molecular weight of 175.15 g/mol. Its IUPAC name is pyrido[2,3-b]pyrazine-6-carboxylic acid.

Molecular Properties

Compound Namepyrido[2,3-b]pyrazine-6-carboxylic acid
PubChem CID4739091
Molecular FormulaC8H5N3O2
Molecular Weight175.15 g/mol
Exact Mass175.04
IUPAC Namepyrido[2,3-b]pyrazine-6-carboxylic acid
SMILESO=C(O)c1ccc2nccnc2n1
InChIInChI=1S/C8H5N3O2/c12-8(13)6-2-1-5-7(11-6)10-4-3-9-5/h1-4H,(H,12,13)
InChIKeyHOBUKUYGYYLBAA-UHFFFAOYSA-N
XLogP0.72
TPSA75.97 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500175.15
LogP ≤ 50.72
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze pyrido[2,3-b]pyrazine-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of pyrido[2,3-b]pyrazine-6-carboxylic acid?
The IUPAC name of pyrido[2,3-b]pyrazine-6-carboxylic acid (CID 4739091) is pyrido[2,3-b]pyrazine-6-carboxylic acid.
What is the SMILES notation for pyrido[2,3-b]pyrazine-6-carboxylic acid?
The canonical SMILES for pyrido[2,3-b]pyrazine-6-carboxylic acid is O=C(O)c1ccc2nccnc2n1.
What is the InChIKey of pyrido[2,3-b]pyrazine-6-carboxylic acid?
The InChIKey is HOBUKUYGYYLBAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N3O2/c12-8(13)6-2-1-5-7(11-6)10-4-3-9-5/h1-4H,(H,12,13).
What are the key properties of pyrido[2,3-b]pyrazine-6-carboxylic acid?
pyrido[2,3-b]pyrazine-6-carboxylic acid has a molecular weight of 175.15 g/mol, XLogP of 0.72, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrido[2,3-b]pyrazine-6-carboxylic acid is sourced from PubChem (CID 4739091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).