About (2-bromo-3-pyridinyl) 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate
(2-bromo-3-pyridinyl) 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate (PubChem CID 47391722) has the molecular formula C15H18BrNO2
and a molecular weight of 324.22 g/mol. Its IUPAC name is (2-bromo-3-pyridinyl) 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | (2-bromo-3-pyridinyl) 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate |
| PubChem CID | 47391722 |
| Molecular Formula | C15H18BrNO2 |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | (2-bromo-3-pyridinyl) 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate |
| SMILES | CC(C)=CC1C(C(=O)Oc2cccnc2Br)C1(C)C |
| InChI | InChI=1S/C15H18BrNO2/c1-9(2)8-10-12(15(10,3)4)14(18)19-11-6-5-7-17-13(11)16/h5-8,10,12H,1-4H3 |
| InChIKey | XWBASYJSCDUVLZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2-bromo-3-pyridinyl) 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromo-3-pyridinyl) 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate?
The IUPAC name of (2-bromo-3-pyridinyl) 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate (CID 47391722) is (2-bromo-3-pyridinyl) 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate.
What is the SMILES notation for (2-bromo-3-pyridinyl) 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate?
The canonical SMILES for (2-bromo-3-pyridinyl) 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate is CC(C)=CC1C(C(=O)Oc2cccnc2Br)C1(C)C.
What is the InChIKey of (2-bromo-3-pyridinyl) 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate?
The InChIKey is XWBASYJSCDUVLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18BrNO2/c1-9(2)8-10-12(15(10,3)4)14(18)19-11-6-5-7-17-13(11)16/h5-8,10,12H,1-4H3.
What are the key properties of (2-bromo-3-pyridinyl) 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate?
(2-bromo-3-pyridinyl) 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate has a molecular weight of 324.22 g/mol, XLogP of 3.99, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromo-3-pyridinyl) 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate is sourced from PubChem (CID 47391722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).