C12H16N4O4 — CID 47394472
1-[2-(ethylcarbamoylamino)-2-oxoethyl]-N-methyl-6-oxopyridine-3-carboxamide (PubChem CID 47394472) has the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is 1-[2-(ethylcarbamoylamino)-2-oxoethyl]-N-methyl-6-oxopyridine-3-carboxamide.
| Compound Name | 1-[2-(ethylcarbamoylamino)-2-oxoethyl]-N-methyl-6-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 47394472 |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 1-[2-(ethylcarbamoylamino)-2-oxoethyl]-N-methyl-6-oxopyridine-3-carboxamide |
| SMILES | CCNC(=O)NC(=O)Cn1cc(C(=O)NC)ccc1=O |
| InChI | InChI=1S/C12H16N4O4/c1-3-14-12(20)15-9(17)7-16-6-8(11(19)13-2)4-5-10(16)18/h4-6H,3,7H2,1-2H3,(H,13,19)(H2,14,15,17,20) |
| InChIKey | YPQKVXNMSQZEHD-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 109.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |