About 3-(4-chlorophenyl)-5-thiophen-2-yl-4,5-dihydro-1H-pyrazole
3-(4-chlorophenyl)-5-thiophen-2-yl-4,5-dihydro-1H-pyrazole (PubChem CID 4739511) has the molecular formula C13H11ClN2S
and a molecular weight of 262.77 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-5-thiophen-2-yl-4,5-dihydro-1H-pyrazole.
Molecular Properties
| Compound Name | 3-(4-chlorophenyl)-5-thiophen-2-yl-4,5-dihydro-1H-pyrazole |
| PubChem CID | 4739511 |
| Molecular Formula | C13H11ClN2S |
| Molecular Weight | 262.77 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | 3-(4-chlorophenyl)-5-thiophen-2-yl-4,5-dihydro-1H-pyrazole |
| SMILES | Clc1ccc(C2=NNC(c3cccs3)C2)cc1 |
| InChI | InChI=1S/C13H11ClN2S/c14-10-5-3-9(4-6-10)11-8-12(16-15-11)13-2-1-7-17-13/h1-7,12,16H,8H2 |
| InChIKey | PGJOSMLVSRNASM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.77 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4-chlorophenyl)-5-thiophen-2-yl-4,5-dihydro-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)-5-thiophen-2-yl-4,5-dihydro-1H-pyrazole?
The IUPAC name of 3-(4-chlorophenyl)-5-thiophen-2-yl-4,5-dihydro-1H-pyrazole (CID 4739511) is 3-(4-chlorophenyl)-5-thiophen-2-yl-4,5-dihydro-1H-pyrazole.
What is the SMILES notation for 3-(4-chlorophenyl)-5-thiophen-2-yl-4,5-dihydro-1H-pyrazole?
The canonical SMILES for 3-(4-chlorophenyl)-5-thiophen-2-yl-4,5-dihydro-1H-pyrazole is Clc1ccc(C2=NNC(c3cccs3)C2)cc1.
What is the InChIKey of 3-(4-chlorophenyl)-5-thiophen-2-yl-4,5-dihydro-1H-pyrazole?
The InChIKey is PGJOSMLVSRNASM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11ClN2S/c14-10-5-3-9(4-6-10)11-8-12(16-15-11)13-2-1-7-17-13/h1-7,12,16H,8H2.
What are the key properties of 3-(4-chlorophenyl)-5-thiophen-2-yl-4,5-dihydro-1H-pyrazole?
3-(4-chlorophenyl)-5-thiophen-2-yl-4,5-dihydro-1H-pyrazole has a molecular weight of 262.77 g/mol, XLogP of 3.84, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-5-thiophen-2-yl-4,5-dihydro-1H-pyrazole is sourced from PubChem (CID 4739511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).