About 2-(2,6-difluoro-N-methylanilino)-N-(3-methyl-1,2-oxazol-5-yl)acetamide
2-(2,6-difluoro-N-methylanilino)-N-(3-methyl-1,2-oxazol-5-yl)acetamide (PubChem CID 47395738) has the molecular formula C13H13F2N3O2
and a molecular weight of 281.26 g/mol. Its IUPAC name is 2-(2,6-difluoro-N-methylanilino)-N-(3-methyl-1,2-oxazol-5-yl)acetamide.
Molecular Properties
| Compound Name | 2-(2,6-difluoro-N-methylanilino)-N-(3-methyl-1,2-oxazol-5-yl)acetamide |
| PubChem CID | 47395738 |
| Molecular Formula | C13H13F2N3O2 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 2-(2,6-difluoro-N-methylanilino)-N-(3-methyl-1,2-oxazol-5-yl)acetamide |
| SMILES | Cc1cc(NC(=O)CN(C)c2c(F)cccc2F)on1 |
| InChI | InChI=1S/C13H13F2N3O2/c1-8-6-12(20-17-8)16-11(19)7-18(2)13-9(14)4-3-5-10(13)15/h3-6H,7H2,1-2H3,(H,16,19) |
| InChIKey | JXVIAFGBVCWQTO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2,6-difluoro-N-methylanilino)-N-(3-methyl-1,2-oxazol-5-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-difluoro-N-methylanilino)-N-(3-methyl-1,2-oxazol-5-yl)acetamide?
The IUPAC name of 2-(2,6-difluoro-N-methylanilino)-N-(3-methyl-1,2-oxazol-5-yl)acetamide (CID 47395738) is 2-(2,6-difluoro-N-methylanilino)-N-(3-methyl-1,2-oxazol-5-yl)acetamide.
What is the SMILES notation for 2-(2,6-difluoro-N-methylanilino)-N-(3-methyl-1,2-oxazol-5-yl)acetamide?
The canonical SMILES for 2-(2,6-difluoro-N-methylanilino)-N-(3-methyl-1,2-oxazol-5-yl)acetamide is Cc1cc(NC(=O)CN(C)c2c(F)cccc2F)on1.
What is the InChIKey of 2-(2,6-difluoro-N-methylanilino)-N-(3-methyl-1,2-oxazol-5-yl)acetamide?
The InChIKey is JXVIAFGBVCWQTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13F2N3O2/c1-8-6-12(20-17-8)16-11(19)7-18(2)13-9(14)4-3-5-10(13)15/h3-6H,7H2,1-2H3,(H,16,19).
What are the key properties of 2-(2,6-difluoro-N-methylanilino)-N-(3-methyl-1,2-oxazol-5-yl)acetamide?
2-(2,6-difluoro-N-methylanilino)-N-(3-methyl-1,2-oxazol-5-yl)acetamide has a molecular weight of 281.26 g/mol, XLogP of 2.34, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-difluoro-N-methylanilino)-N-(3-methyl-1,2-oxazol-5-yl)acetamide is sourced from PubChem (CID 47395738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).