C10H14F3N5O — CID 47401544
1-[3-(pyrimidin-2-ylamino)propyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 47401544) has the molecular formula C10H14F3N5O and a molecular weight of 277.25 g/mol. Its IUPAC name is 1-[3-(pyrimidin-2-ylamino)propyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[3-(pyrimidin-2-ylamino)propyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 47401544 |
| Molecular Formula | C10H14F3N5O |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 1-[3-(pyrimidin-2-ylamino)propyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | O=C(NCCCNc1ncccn1)NCC(F)(F)F |
| InChI | InChI=1S/C10H14F3N5O/c11-10(12,13)7-18-9(19)17-6-2-5-16-8-14-3-1-4-15-8/h1,3-4H,2,5-7H2,(H,14,15,16)(H2,17,18,19) |
| InChIKey | ALCFDLHRDATWCK-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|