About 4-sulfamoyl-N-(2,2,2-trifluoroethyl)piperazine-1-carboxamide
4-sulfamoyl-N-(2,2,2-trifluoroethyl)piperazine-1-carboxamide (PubChem CID 47401631) has the molecular formula C7H13F3N4O3S
and a molecular weight of 290.27 g/mol. Its IUPAC name is 4-sulfamoyl-N-(2,2,2-trifluoroethyl)piperazine-1-carboxamide.
Molecular Properties
| Compound Name | 4-sulfamoyl-N-(2,2,2-trifluoroethyl)piperazine-1-carboxamide |
| PubChem CID | 47401631 |
| Molecular Formula | C7H13F3N4O3S |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 4-sulfamoyl-N-(2,2,2-trifluoroethyl)piperazine-1-carboxamide |
| SMILES | NS(=O)(=O)N1CCN(C(=O)NCC(F)(F)F)CC1 |
| InChI | InChI=1S/C7H13F3N4O3S/c8-7(9,10)5-12-6(15)13-1-3-14(4-2-13)18(11,16)17/h1-5H2,(H,12,15)(H2,11,16,17) |
| InChIKey | ASHMBYFQFFTBMQ-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-sulfamoyl-N-(2,2,2-trifluoroethyl)piperazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-sulfamoyl-N-(2,2,2-trifluoroethyl)piperazine-1-carboxamide?
The IUPAC name of 4-sulfamoyl-N-(2,2,2-trifluoroethyl)piperazine-1-carboxamide (CID 47401631) is 4-sulfamoyl-N-(2,2,2-trifluoroethyl)piperazine-1-carboxamide.
What is the SMILES notation for 4-sulfamoyl-N-(2,2,2-trifluoroethyl)piperazine-1-carboxamide?
The canonical SMILES for 4-sulfamoyl-N-(2,2,2-trifluoroethyl)piperazine-1-carboxamide is NS(=O)(=O)N1CCN(C(=O)NCC(F)(F)F)CC1.
What is the InChIKey of 4-sulfamoyl-N-(2,2,2-trifluoroethyl)piperazine-1-carboxamide?
The InChIKey is ASHMBYFQFFTBMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13F3N4O3S/c8-7(9,10)5-12-6(15)13-1-3-14(4-2-13)18(11,16)17/h1-5H2,(H,12,15)(H2,11,16,17).
What are the key properties of 4-sulfamoyl-N-(2,2,2-trifluoroethyl)piperazine-1-carboxamide?
4-sulfamoyl-N-(2,2,2-trifluoroethyl)piperazine-1-carboxamide has a molecular weight of 290.27 g/mol, XLogP of -0.92, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-sulfamoyl-N-(2,2,2-trifluoroethyl)piperazine-1-carboxamide is sourced from PubChem (CID 47401631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).