C14H19N3O2S — CID 47405516
N-[(3-cyanophenyl)methyl]-2-methylpiperidine-1-sulfonamide (PubChem CID 47405516) has the molecular formula C14H19N3O2S and a molecular weight of 293.39 g/mol. Its IUPAC name is N-[(3-cyanophenyl)methyl]-2-methylpiperidine-1-sulfonamide.
| Compound Name | N-[(3-cyanophenyl)methyl]-2-methylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 47405516 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | N-[(3-cyanophenyl)methyl]-2-methylpiperidine-1-sulfonamide |
| SMILES | CC1CCCCN1S(=O)(=O)NCc1cccc(C#N)c1 |
| InChI | InChI=1S/C14H19N3O2S/c1-12-5-2-3-8-17(12)20(18,19)16-11-14-7-4-6-13(9-14)10-15/h4,6-7,9,12,16H,2-3,5,8,11H2,1H3 |
| InChIKey | ZMPCKMFWVCUFHT-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |