About 3-phenylpropanoate
3-phenylpropanoate (PubChem CID 4740700) has the molecular formula C9H9O2-
and a molecular weight of 149.17 g/mol. Its IUPAC name is 3-phenylpropanoate.
Molecular Properties
| Compound Name | 3-phenylpropanoate |
| PubChem CID | 4740700 |
| Molecular Formula | C9H9O2- |
| Molecular Weight | 149.17 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | 3-phenylpropanoate |
| SMILES | O=C([O-])CCc1ccccc1 |
| InChI | InChI=1S/C9H10O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,10,11)/p-1 |
| InChIKey | XMIIGOLPHOKFCH-UHFFFAOYSA-M |
| XLogP | 0.37 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.17 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylpropanoate?
The IUPAC name of 3-phenylpropanoate (CID 4740700) is 3-phenylpropanoate.
What is the SMILES notation for 3-phenylpropanoate?
The canonical SMILES for 3-phenylpropanoate is O=C([O-])CCc1ccccc1.
What is the InChIKey of 3-phenylpropanoate?
The InChIKey is XMIIGOLPHOKFCH-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H10O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,10,11)/p-1.
What are the key properties of 3-phenylpropanoate?
3-phenylpropanoate has a molecular weight of 149.17 g/mol, XLogP of 0.37, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylpropanoate is sourced from PubChem (CID 4740700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).