C11H13ClN4O3 — CID 47409666
5-chloro-2-[[2-(methylcarbamoylamino)-2-oxoethyl]amino]benzamide (PubChem CID 47409666) has the molecular formula C11H13ClN4O3 and a molecular weight of 284.70 g/mol. Its IUPAC name is 5-chloro-2-[[2-(methylcarbamoylamino)-2-oxoethyl]amino]benzamide.
| Compound Name | 5-chloro-2-[[2-(methylcarbamoylamino)-2-oxoethyl]amino]benzamide |
|---|---|
| PubChem CID | 47409666 |
| Molecular Formula | C11H13ClN4O3 |
| Molecular Weight | 284.70 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 5-chloro-2-[[2-(methylcarbamoylamino)-2-oxoethyl]amino]benzamide |
| SMILES | CNC(=O)NC(=O)CNc1ccc(Cl)cc1C(N)=O |
| InChI | InChI=1S/C11H13ClN4O3/c1-14-11(19)16-9(17)5-15-8-3-2-6(12)4-7(8)10(13)18/h2-4,15H,5H2,1H3,(H2,13,18)(H2,14,16,17,19) |
| InChIKey | UKXORPBDDSMCJV-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.70 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |