About N-[2-(2,5-dimethylmorpholin-4-yl)-2-oxoethyl]-3,3-dimethylbutanamide
N-[2-(2,5-dimethylmorpholin-4-yl)-2-oxoethyl]-3,3-dimethylbutanamide (PubChem CID 47412713) has the molecular formula C14H26N2O3
and a molecular weight of 270.37 g/mol. Its IUPAC name is N-[2-(2,5-dimethylmorpholin-4-yl)-2-oxoethyl]-3,3-dimethylbutanamide.
Molecular Properties
| Compound Name | N-[2-(2,5-dimethylmorpholin-4-yl)-2-oxoethyl]-3,3-dimethylbutanamide |
| PubChem CID | 47412713 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | N-[2-(2,5-dimethylmorpholin-4-yl)-2-oxoethyl]-3,3-dimethylbutanamide |
| SMILES | CC1CN(C(=O)CNC(=O)CC(C)(C)C)C(C)CO1 |
| InChI | InChI=1S/C14H26N2O3/c1-10-9-19-11(2)8-16(10)13(18)7-15-12(17)6-14(3,4)5/h10-11H,6-9H2,1-5H3,(H,15,17) |
| InChIKey | AWJUMIXWARSRJE-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-(2,5-dimethylmorpholin-4-yl)-2-oxoethyl]-3,3-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,5-dimethylmorpholin-4-yl)-2-oxoethyl]-3,3-dimethylbutanamide?
The IUPAC name of N-[2-(2,5-dimethylmorpholin-4-yl)-2-oxoethyl]-3,3-dimethylbutanamide (CID 47412713) is N-[2-(2,5-dimethylmorpholin-4-yl)-2-oxoethyl]-3,3-dimethylbutanamide.
What is the SMILES notation for N-[2-(2,5-dimethylmorpholin-4-yl)-2-oxoethyl]-3,3-dimethylbutanamide?
The canonical SMILES for N-[2-(2,5-dimethylmorpholin-4-yl)-2-oxoethyl]-3,3-dimethylbutanamide is CC1CN(C(=O)CNC(=O)CC(C)(C)C)C(C)CO1.
What is the InChIKey of N-[2-(2,5-dimethylmorpholin-4-yl)-2-oxoethyl]-3,3-dimethylbutanamide?
The InChIKey is AWJUMIXWARSRJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2O3/c1-10-9-19-11(2)8-16(10)13(18)7-15-12(17)6-14(3,4)5/h10-11H,6-9H2,1-5H3,(H,15,17).
What are the key properties of N-[2-(2,5-dimethylmorpholin-4-yl)-2-oxoethyl]-3,3-dimethylbutanamide?
N-[2-(2,5-dimethylmorpholin-4-yl)-2-oxoethyl]-3,3-dimethylbutanamide has a molecular weight of 270.37 g/mol, XLogP of 1.17, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,5-dimethylmorpholin-4-yl)-2-oxoethyl]-3,3-dimethylbutanamide is sourced from PubChem (CID 47412713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).