C10H15N5O4 — CID 47414917
1-(2,5-dimethylmorpholin-4-yl)-2-(3-nitro-1,2,4-triazol-1-yl)ethanone (PubChem CID 47414917) has the molecular formula C10H15N5O4 and a molecular weight of 269.26 g/mol. Its IUPAC name is 1-(2,5-dimethylmorpholin-4-yl)-2-(3-nitro-1,2,4-triazol-1-yl)ethanone.
| Compound Name | 1-(2,5-dimethylmorpholin-4-yl)-2-(3-nitro-1,2,4-triazol-1-yl)ethanone |
|---|---|
| PubChem CID | 47414917 |
| Molecular Formula | C10H15N5O4 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 1-(2,5-dimethylmorpholin-4-yl)-2-(3-nitro-1,2,4-triazol-1-yl)ethanone |
| SMILES | CC1CN(C(=O)Cn2cnc([N+](=O)[O-])n2)C(C)CO1 |
| InChI | InChI=1S/C10H15N5O4/c1-7-5-19-8(2)3-14(7)9(16)4-13-6-11-10(12-13)15(17)18/h6-8H,3-5H2,1-2H3 |
| InChIKey | NVQBXAOKSDSRLV-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 103.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|