About 1-cyclopropylpiperazine
1-cyclopropylpiperazine (PubChem CID 4742004) has the molecular formula C7H14N2
and a molecular weight of 126.20 g/mol. Its IUPAC name is 1-cyclopropylpiperazine.
Molecular Properties
| Compound Name | 1-cyclopropylpiperazine |
| PubChem CID | 4742004 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | 1-cyclopropylpiperazine |
| SMILES | C1CN(C2CC2)CCN1 |
| InChI | InChI=1S/C7H14N2/c1-2-7(1)9-5-3-8-4-6-9/h7-8H,1-6H2 |
| InChIKey | HNZJIWIXRPBFAN-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclopropylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropylpiperazine?
The IUPAC name of 1-cyclopropylpiperazine (CID 4742004) is 1-cyclopropylpiperazine.
What is the SMILES notation for 1-cyclopropylpiperazine?
The canonical SMILES for 1-cyclopropylpiperazine is C1CN(C2CC2)CCN1.
What is the InChIKey of 1-cyclopropylpiperazine?
The InChIKey is HNZJIWIXRPBFAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2/c1-2-7(1)9-5-3-8-4-6-9/h7-8H,1-6H2.
What are the key properties of 1-cyclopropylpiperazine?
1-cyclopropylpiperazine has a molecular weight of 126.20 g/mol, XLogP of 0.05, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropylpiperazine is sourced from PubChem (CID 4742004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).