C21H25N3O3 — CID 4742344
4-[4-[1-(3,4-dimethylphenyl)ethyl]piperazin-1-yl]-3-nitrobenzaldehyde (PubChem CID 4742344) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is 4-[4-[1-(3,4-dimethylphenyl)ethyl]piperazin-1-yl]-3-nitrobenzaldehyde.
| Compound Name | 4-[4-[1-(3,4-dimethylphenyl)ethyl]piperazin-1-yl]-3-nitrobenzaldehyde |
|---|---|
| PubChem CID | 4742344 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 4-[4-[1-(3,4-dimethylphenyl)ethyl]piperazin-1-yl]-3-nitrobenzaldehyde |
| SMILES | Cc1ccc(C(C)N2CCN(c3ccc(C=O)cc3[N+](=O)[O-])CC2)cc1C |
| InChI | InChI=1S/C21H25N3O3/c1-15-4-6-19(12-16(15)2)17(3)22-8-10-23(11-9-22)20-7-5-18(14-25)13-21(20)24(26)27/h4-7,12-14,17H,8-11H2,1-3H3 |
| InChIKey | ZLTPEZIUGRKMBN-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|