About 2-cyano-N,5,5-tricyclopropyl-3-oxopentanamide
2-cyano-N,5,5-tricyclopropyl-3-oxopentanamide (PubChem CID 47425508) has the molecular formula C15H20N2O2
and a molecular weight of 260.34 g/mol. Its IUPAC name is 2-cyano-N,5,5-tricyclopropyl-3-oxopentanamide.
Molecular Properties
| Compound Name | 2-cyano-N,5,5-tricyclopropyl-3-oxopentanamide |
| PubChem CID | 47425508 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 2-cyano-N,5,5-tricyclopropyl-3-oxopentanamide |
| SMILES | N#CC(C(=O)CC(C1CC1)C1CC1)C(=O)NC1CC1 |
| InChI | InChI=1S/C15H20N2O2/c16-8-13(15(19)17-11-5-6-11)14(18)7-12(9-1-2-9)10-3-4-10/h9-13H,1-7H2,(H,17,19) |
| InChIKey | MRXLOVVSNYZKIV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-cyano-N,5,5-tricyclopropyl-3-oxopentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-N,5,5-tricyclopropyl-3-oxopentanamide?
The IUPAC name of 2-cyano-N,5,5-tricyclopropyl-3-oxopentanamide (CID 47425508) is 2-cyano-N,5,5-tricyclopropyl-3-oxopentanamide.
What is the SMILES notation for 2-cyano-N,5,5-tricyclopropyl-3-oxopentanamide?
The canonical SMILES for 2-cyano-N,5,5-tricyclopropyl-3-oxopentanamide is N#CC(C(=O)CC(C1CC1)C1CC1)C(=O)NC1CC1.
What is the InChIKey of 2-cyano-N,5,5-tricyclopropyl-3-oxopentanamide?
The InChIKey is MRXLOVVSNYZKIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O2/c16-8-13(15(19)17-11-5-6-11)14(18)7-12(9-1-2-9)10-3-4-10/h9-13H,1-7H2,(H,17,19).
What are the key properties of 2-cyano-N,5,5-tricyclopropyl-3-oxopentanamide?
2-cyano-N,5,5-tricyclopropyl-3-oxopentanamide has a molecular weight of 260.34 g/mol, XLogP of 1.80, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-N,5,5-tricyclopropyl-3-oxopentanamide is sourced from PubChem (CID 47425508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).