About 2-ethyl-N-(5-propan-2-yl-1H-pyrazol-3-yl)-1,3-thiazole-5-carboxamide
2-ethyl-N-(5-propan-2-yl-1H-pyrazol-3-yl)-1,3-thiazole-5-carboxamide (PubChem CID 47429730) has the molecular formula C12H16N4OS
and a molecular weight of 264.35 g/mol. Its IUPAC name is 2-ethyl-N-(5-propan-2-yl-1H-pyrazol-3-yl)-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 2-ethyl-N-(5-propan-2-yl-1H-pyrazol-3-yl)-1,3-thiazole-5-carboxamide |
| PubChem CID | 47429730 |
| Molecular Formula | C12H16N4OS |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 2-ethyl-N-(5-propan-2-yl-1H-pyrazol-3-yl)-1,3-thiazole-5-carboxamide |
| SMILES | CCc1ncc(C(=O)Nc2cc(C(C)C)[nH]n2)s1 |
| InChI | InChI=1S/C12H16N4OS/c1-4-11-13-6-9(18-11)12(17)14-10-5-8(7(2)3)15-16-10/h5-7H,4H2,1-3H3,(H2,14,15,16,17) |
| InChIKey | UPFPURHSUJJBRM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethyl-N-(5-propan-2-yl-1H-pyrazol-3-yl)-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-N-(5-propan-2-yl-1H-pyrazol-3-yl)-1,3-thiazole-5-carboxamide?
The IUPAC name of 2-ethyl-N-(5-propan-2-yl-1H-pyrazol-3-yl)-1,3-thiazole-5-carboxamide (CID 47429730) is 2-ethyl-N-(5-propan-2-yl-1H-pyrazol-3-yl)-1,3-thiazole-5-carboxamide.
What is the SMILES notation for 2-ethyl-N-(5-propan-2-yl-1H-pyrazol-3-yl)-1,3-thiazole-5-carboxamide?
The canonical SMILES for 2-ethyl-N-(5-propan-2-yl-1H-pyrazol-3-yl)-1,3-thiazole-5-carboxamide is CCc1ncc(C(=O)Nc2cc(C(C)C)[nH]n2)s1.
What is the InChIKey of 2-ethyl-N-(5-propan-2-yl-1H-pyrazol-3-yl)-1,3-thiazole-5-carboxamide?
The InChIKey is UPFPURHSUJJBRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4OS/c1-4-11-13-6-9(18-11)12(17)14-10-5-8(7(2)3)15-16-10/h5-7H,4H2,1-3H3,(H2,14,15,16,17).
What are the key properties of 2-ethyl-N-(5-propan-2-yl-1H-pyrazol-3-yl)-1,3-thiazole-5-carboxamide?
2-ethyl-N-(5-propan-2-yl-1H-pyrazol-3-yl)-1,3-thiazole-5-carboxamide has a molecular weight of 264.35 g/mol, XLogP of 2.80, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-N-(5-propan-2-yl-1H-pyrazol-3-yl)-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 47429730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).