C11H14N3S3+ — CID 4743396
11-ethyl-8-thia-4,6-diaza-11-azoniatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-3,5-dithione (PubChem CID 4743396) has the molecular formula C11H14N3S3+ and a molecular weight of 284.45 g/mol. Its IUPAC name is 11-ethyl-8-thia-4,6-diaza-11-azoniatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-3,5-dithione.
| Compound Name | 11-ethyl-8-thia-4,6-diaza-11-azoniatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-3,5-dithione |
|---|---|
| PubChem CID | 4743396 |
| Molecular Formula | C11H14N3S3+ |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | 11-ethyl-8-thia-4,6-diaza-11-azoniatricyclo[7.4.0.02,7]trideca-1(9),2(7)-diene-3,5-dithione |
| SMILES | CC[NH+]1CCc2c(sc3[nH]c(=S)[nH]c(=S)c23)C1 |
| InChI | InChI=1S/C11H13N3S3/c1-2-14-4-3-6-7(5-14)17-10-8(6)9(15)12-11(16)13-10/h2-5H2,1H3,(H2,12,13,15,16)/p+1 |
| InChIKey | FUPYBTPPRHUERR-UHFFFAOYSA-O |
| XLogP | 1.98 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|