About 4-bromo-2-hydroxy-N,N-dimethylbenzamide
4-bromo-2-hydroxy-N,N-dimethylbenzamide (PubChem CID 47435796) has the molecular formula C9H10BrNO2
and a molecular weight of 244.09 g/mol. Its IUPAC name is 4-bromo-2-hydroxy-N,N-dimethylbenzamide.
Molecular Properties
| Compound Name | 4-bromo-2-hydroxy-N,N-dimethylbenzamide |
| PubChem CID | 47435796 |
| Molecular Formula | C9H10BrNO2 |
| Molecular Weight | 244.09 g/mol |
| Exact Mass | 242.99 |
| IUPAC Name | 4-bromo-2-hydroxy-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(Br)cc1O |
| InChI | InChI=1S/C9H10BrNO2/c1-11(2)9(13)7-4-3-6(10)5-8(7)12/h3-5,12H,1-2H3 |
| InChIKey | XTDKZCLZWZIPGN-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.09 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-2-hydroxy-N,N-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-hydroxy-N,N-dimethylbenzamide?
The IUPAC name of 4-bromo-2-hydroxy-N,N-dimethylbenzamide (CID 47435796) is 4-bromo-2-hydroxy-N,N-dimethylbenzamide.
What is the SMILES notation for 4-bromo-2-hydroxy-N,N-dimethylbenzamide?
The canonical SMILES for 4-bromo-2-hydroxy-N,N-dimethylbenzamide is CN(C)C(=O)c1ccc(Br)cc1O.
What is the InChIKey of 4-bromo-2-hydroxy-N,N-dimethylbenzamide?
The InChIKey is XTDKZCLZWZIPGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BrNO2/c1-11(2)9(13)7-4-3-6(10)5-8(7)12/h3-5,12H,1-2H3.
What are the key properties of 4-bromo-2-hydroxy-N,N-dimethylbenzamide?
4-bromo-2-hydroxy-N,N-dimethylbenzamide has a molecular weight of 244.09 g/mol, XLogP of 1.86, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-hydroxy-N,N-dimethylbenzamide is sourced from PubChem (CID 47435796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).