C15H23N6O3+ — CID 4743581
7-[2-(4-ethylpiperazin-1-yl)-2-oxoethyl]-1,3-dimethyl-9H-purin-7-ium-2,6-dione (PubChem CID 4743581) has the molecular formula C15H23N6O3+ and a molecular weight of 335.39 g/mol. Its IUPAC name is 7-[2-(4-ethylpiperazin-1-yl)-2-oxoethyl]-1,3-dimethyl-9H-purin-7-ium-2,6-dione.
| Compound Name | 7-[2-(4-ethylpiperazin-1-yl)-2-oxoethyl]-1,3-dimethyl-9H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 4743581 |
| Molecular Formula | C15H23N6O3+ |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 7-[2-(4-ethylpiperazin-1-yl)-2-oxoethyl]-1,3-dimethyl-9H-purin-7-ium-2,6-dione |
| SMILES | CCN1CCN(C(=O)C[n+]2c[nH]c3c2c(=O)n(C)c(=O)n3C)CC1 |
| InChI | InChI=1S/C15H22N6O3/c1-4-19-5-7-20(8-6-19)11(22)9-21-10-16-13-12(21)14(23)18(3)15(24)17(13)2/h10H,4-9H2,1-3H3/p+1 |
| InChIKey | LYJYLXGOATUFHI-UHFFFAOYSA-O |
| XLogP | -1.98 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|