C17H30N2O3+2 — CID 4744187
1-propan-2-yl-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1,4-diium (PubChem CID 4744187) has the molecular formula C17H30N2O3+2 and a molecular weight of 310.44 g/mol. Its IUPAC name is 1-propan-2-yl-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1,4-diium.
| Compound Name | 1-propan-2-yl-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1,4-diium |
|---|---|
| PubChem CID | 4744187 |
| Molecular Formula | C17H30N2O3+2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | 1-propan-2-yl-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine-1,4-diium |
| SMILES | COc1cc(C[NH+]2CC[NH+](C(C)C)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C17H28N2O3/c1-13(2)19-8-6-18(7-9-19)12-14-10-15(20-3)17(22-5)16(11-14)21-4/h10-11,13H,6-9,12H2,1-5H3/p+2 |
| InChIKey | VSSNDYMBRHYPKO-UHFFFAOYSA-P |
| XLogP | -0.60 |
| TPSA | 36.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |