C12H16Cl2N2O2 — CID 47442422
1-[2-(3,5-dichlorophenyl)ethyl]-3-(2-methoxyethyl)urea (PubChem CID 47442422) has the molecular formula C12H16Cl2N2O2 and a molecular weight of 291.18 g/mol. Its IUPAC name is 1-[2-(3,5-dichlorophenyl)ethyl]-3-(2-methoxyethyl)urea.
| Compound Name | 1-[2-(3,5-dichlorophenyl)ethyl]-3-(2-methoxyethyl)urea |
|---|---|
| PubChem CID | 47442422 |
| Molecular Formula | C12H16Cl2N2O2 |
| Molecular Weight | 291.18 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 1-[2-(3,5-dichlorophenyl)ethyl]-3-(2-methoxyethyl)urea |
| SMILES | COCCNC(=O)NCCc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H16Cl2N2O2/c1-18-5-4-16-12(17)15-3-2-9-6-10(13)8-11(14)7-9/h6-8H,2-5H2,1H3,(H2,15,16,17) |
| InChIKey | FAVLLYXUERXSTC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.18 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|