C19H29N2O3+ — CID 4744244
(4-cyclohexylpiperazin-4-ium-1-yl)-(3,5-dimethoxyphenyl)methanone (PubChem CID 4744244) has the molecular formula C19H29N2O3+ and a molecular weight of 333.45 g/mol. Its IUPAC name is (4-cyclohexylpiperazin-4-ium-1-yl)-(3,5-dimethoxyphenyl)methanone.
| Compound Name | (4-cyclohexylpiperazin-4-ium-1-yl)-(3,5-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 4744244 |
| Molecular Formula | C19H29N2O3+ |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | (4-cyclohexylpiperazin-4-ium-1-yl)-(3,5-dimethoxyphenyl)methanone |
| SMILES | COc1cc(OC)cc(C(=O)N2CC[NH+](C3CCCCC3)CC2)c1 |
| InChI | InChI=1S/C19H28N2O3/c1-23-17-12-15(13-18(14-17)24-2)19(22)21-10-8-20(9-11-21)16-6-4-3-5-7-16/h12-14,16H,3-11H2,1-2H3/p+1 |
| InChIKey | DDCXDFCSGZSAMR-UHFFFAOYSA-O |
| XLogP | 1.38 |
| TPSA | 43.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |