About (5-bromo-2,3-dihydroindol-1-yl)-(4-fluorophenyl)methanone
(5-bromo-2,3-dihydroindol-1-yl)-(4-fluorophenyl)methanone (PubChem CID 47444516) has the molecular formula C15H11BrFNO
and a molecular weight of 320.16 g/mol. Its IUPAC name is (5-bromo-2,3-dihydroindol-1-yl)-(4-fluorophenyl)methanone.
Molecular Properties
| Compound Name | (5-bromo-2,3-dihydroindol-1-yl)-(4-fluorophenyl)methanone |
| PubChem CID | 47444516 |
| Molecular Formula | C15H11BrFNO |
| Molecular Weight | 320.16 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | (5-bromo-2,3-dihydroindol-1-yl)-(4-fluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)cc1)N1CCc2cc(Br)ccc21 |
| InChI | InChI=1S/C15H11BrFNO/c16-12-3-6-14-11(9-12)7-8-18(14)15(19)10-1-4-13(17)5-2-10/h1-6,9H,7-8H2 |
| InChIKey | IDQRKDUXLZTIPH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.16 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (5-bromo-2,3-dihydroindol-1-yl)-(4-fluorophenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-bromo-2,3-dihydroindol-1-yl)-(4-fluorophenyl)methanone?
The IUPAC name of (5-bromo-2,3-dihydroindol-1-yl)-(4-fluorophenyl)methanone (CID 47444516) is (5-bromo-2,3-dihydroindol-1-yl)-(4-fluorophenyl)methanone.
What is the SMILES notation for (5-bromo-2,3-dihydroindol-1-yl)-(4-fluorophenyl)methanone?
The canonical SMILES for (5-bromo-2,3-dihydroindol-1-yl)-(4-fluorophenyl)methanone is O=C(c1ccc(F)cc1)N1CCc2cc(Br)ccc21.
What is the InChIKey of (5-bromo-2,3-dihydroindol-1-yl)-(4-fluorophenyl)methanone?
The InChIKey is IDQRKDUXLZTIPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11BrFNO/c16-12-3-6-14-11(9-12)7-8-18(14)15(19)10-1-4-13(17)5-2-10/h1-6,9H,7-8H2.
What are the key properties of (5-bromo-2,3-dihydroindol-1-yl)-(4-fluorophenyl)methanone?
(5-bromo-2,3-dihydroindol-1-yl)-(4-fluorophenyl)methanone has a molecular weight of 320.16 g/mol, XLogP of 3.79, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5-bromo-2,3-dihydroindol-1-yl)-(4-fluorophenyl)methanone is sourced from PubChem (CID 47444516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).