About N-(1-cyanocyclobutyl)-N,1-dimethylindole-2-carboxamide
N-(1-cyanocyclobutyl)-N,1-dimethylindole-2-carboxamide (PubChem CID 47445560) has the molecular formula C16H17N3O
and a molecular weight of 267.33 g/mol. Its IUPAC name is N-(1-cyanocyclobutyl)-N,1-dimethylindole-2-carboxamide.
Molecular Properties
| Compound Name | N-(1-cyanocyclobutyl)-N,1-dimethylindole-2-carboxamide |
| PubChem CID | 47445560 |
| Molecular Formula | C16H17N3O |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | N-(1-cyanocyclobutyl)-N,1-dimethylindole-2-carboxamide |
| SMILES | CN(C(=O)c1cc2ccccc2n1C)C1(C#N)CCC1 |
| InChI | InChI=1S/C16H17N3O/c1-18-13-7-4-3-6-12(13)10-14(18)15(20)19(2)16(11-17)8-5-9-16/h3-4,6-7,10H,5,8-9H2,1-2H3 |
| InChIKey | PCRJTDSYZKNBDU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 49.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1-cyanocyclobutyl)-N,1-dimethylindole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-cyanocyclobutyl)-N,1-dimethylindole-2-carboxamide?
The IUPAC name of N-(1-cyanocyclobutyl)-N,1-dimethylindole-2-carboxamide (CID 47445560) is N-(1-cyanocyclobutyl)-N,1-dimethylindole-2-carboxamide.
What is the SMILES notation for N-(1-cyanocyclobutyl)-N,1-dimethylindole-2-carboxamide?
The canonical SMILES for N-(1-cyanocyclobutyl)-N,1-dimethylindole-2-carboxamide is CN(C(=O)c1cc2ccccc2n1C)C1(C#N)CCC1.
What is the InChIKey of N-(1-cyanocyclobutyl)-N,1-dimethylindole-2-carboxamide?
The InChIKey is PCRJTDSYZKNBDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3O/c1-18-13-7-4-3-6-12(13)10-14(18)15(20)19(2)16(11-17)8-5-9-16/h3-4,6-7,10H,5,8-9H2,1-2H3.
What are the key properties of N-(1-cyanocyclobutyl)-N,1-dimethylindole-2-carboxamide?
N-(1-cyanocyclobutyl)-N,1-dimethylindole-2-carboxamide has a molecular weight of 267.33 g/mol, XLogP of 2.70, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-cyanocyclobutyl)-N,1-dimethylindole-2-carboxamide is sourced from PubChem (CID 47445560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).