C13H15ClN4OS — CID 47446108
[4-[(4-chloropyrazol-1-yl)methyl]piperazin-1-yl]-thiophen-2-ylmethanone (PubChem CID 47446108) has the molecular formula C13H15ClN4OS and a molecular weight of 310.81 g/mol. Its IUPAC name is [4-[(4-chloropyrazol-1-yl)methyl]piperazin-1-yl]-thiophen-2-ylmethanone.
| Compound Name | [4-[(4-chloropyrazol-1-yl)methyl]piperazin-1-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 47446108 |
| Molecular Formula | C13H15ClN4OS |
| Molecular Weight | 310.81 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | [4-[(4-chloropyrazol-1-yl)methyl]piperazin-1-yl]-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)N1CCN(Cn2cc(Cl)cn2)CC1 |
| InChI | InChI=1S/C13H15ClN4OS/c14-11-8-15-18(9-11)10-16-3-5-17(6-4-16)13(19)12-2-1-7-20-12/h1-2,7-9H,3-6,10H2 |
| InChIKey | IWMLSKSFCNUFMR-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.81 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |