C15H20N4O3 — CID 4744650
2-nitro-N'-(1-propan-2-yl-3,6-dihydro-2H-pyridin-4-yl)benzohydrazide (PubChem CID 4744650) has the molecular formula C15H20N4O3 and a molecular weight of 304.35 g/mol. Its IUPAC name is 2-nitro-N'-(1-propan-2-yl-3,6-dihydro-2H-pyridin-4-yl)benzohydrazide.
| Compound Name | 2-nitro-N'-(1-propan-2-yl-3,6-dihydro-2H-pyridin-4-yl)benzohydrazide |
|---|---|
| PubChem CID | 4744650 |
| Molecular Formula | C15H20N4O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 2-nitro-N'-(1-propan-2-yl-3,6-dihydro-2H-pyridin-4-yl)benzohydrazide |
| SMILES | CC(C)N1CC=C(NNC(=O)c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C15H20N4O3/c1-11(2)18-9-7-12(8-10-18)16-17-15(20)13-5-3-4-6-14(13)19(21)22/h3-7,11,16H,8-10H2,1-2H3,(H,17,20) |
| InChIKey | VARPJPDEWXUZMV-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|