C12H17ClN2O3S — CID 47446513
2-[3-(4-chlorophenyl)sulfonylpropyl-methylamino]acetamide (PubChem CID 47446513) has the molecular formula C12H17ClN2O3S and a molecular weight of 304.80 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)sulfonylpropyl-methylamino]acetamide.
| Compound Name | 2-[3-(4-chlorophenyl)sulfonylpropyl-methylamino]acetamide |
|---|---|
| PubChem CID | 47446513 |
| Molecular Formula | C12H17ClN2O3S |
| Molecular Weight | 304.80 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 2-[3-(4-chlorophenyl)sulfonylpropyl-methylamino]acetamide |
| SMILES | CN(CCCS(=O)(=O)c1ccc(Cl)cc1)CC(N)=O |
| InChI | InChI=1S/C12H17ClN2O3S/c1-15(9-12(14)16)7-2-8-19(17,18)11-5-3-10(13)4-6-11/h3-6H,2,7-9H2,1H3,(H2,14,16) |
| InChIKey | JJIMTWVXUOTUNT-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.80 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |