C11H14N2O2S — CID 47449269
N-carbamoyl-2-(3-methylphenyl)sulfanylpropanamide (PubChem CID 47449269) has the molecular formula C11H14N2O2S and a molecular weight of 238.31 g/mol. Its IUPAC name is N-carbamoyl-2-(3-methylphenyl)sulfanylpropanamide.
| Compound Name | N-carbamoyl-2-(3-methylphenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 47449269 |
| Molecular Formula | C11H14N2O2S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | N-carbamoyl-2-(3-methylphenyl)sulfanylpropanamide |
| SMILES | Cc1cccc(SC(C)C(=O)NC(N)=O)c1 |
| InChI | InChI=1S/C11H14N2O2S/c1-7-4-3-5-9(6-7)16-8(2)10(14)13-11(12)15/h3-6,8H,1-2H3,(H3,12,13,14,15) |
| InChIKey | HQJKXSQODWQWOJ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |