C12H19N5O3 — CID 47451667
tert-butyl N-[(2R)-1-oxo-1-(2-pyrimidin-2-ylhydrazinyl)propan-2-yl]carbamate (PubChem CID 47451667) has the molecular formula C12H19N5O3 and a molecular weight of 281.32 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-oxo-1-(2-pyrimidin-2-ylhydrazinyl)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-oxo-1-(2-pyrimidin-2-ylhydrazinyl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 47451667 |
| Molecular Formula | C12H19N5O3 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | tert-butyl N-[(2R)-1-oxo-1-(2-pyrimidin-2-ylhydrazinyl)propan-2-yl]carbamate |
| SMILES | C[C@@H](NC(=O)OC(C)(C)C)C(=O)NNc1ncccn1 |
| InChI | InChI=1S/C12H19N5O3/c1-8(15-11(19)20-12(2,3)4)9(18)16-17-10-13-6-5-7-14-10/h5-8H,1-4H3,(H,15,19)(H,16,18)(H,13,14,17)/t8-/m1/s1 |
| InChIKey | HIQITZIOVWXWLD-MRVPVSSYSA-N |
| XLogP | 0.83 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|