C15H22O2 — CID 474517
(3Ar,4as,8ar,9ar)-3,8a-dimethyl-5-methylene-3a,4,4a,6,7,8,9,9a-octahydro-3h-benzo[f]benzofuran-2-one (PubChem CID 474517) has the molecular formula C15H22O2 and a molecular weight of 234.33 g/mol. Its IUPAC name is (3aR,4aS,8aR,9aR)-3,8a-dimethyl-5-methylidene-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-2-one.
| Compound Name | (3Ar,4as,8ar,9ar)-3,8a-dimethyl-5-methylene-3a,4,4a,6,7,8,9,9a-octahydro-3h-benzo[f]benzofuran-2-one |
|---|---|
| PubChem CID | 474517 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (3aR,4aS,8aR,9aR)-3,8a-dimethyl-5-methylidene-3a,4,4a,6,7,8,9,9a-octahydro-3H-benzo[f][1]benzofuran-2-one |
| SMILES | CC1[C@H]2C[C@H]3C(=C)CCC[C@@]3(C[C@H]2OC1=O)C |
| InChI | InChI=1S/C15H22O2/c1-9-5-4-6-15(3)8-13-11(7-12(9)15)10(2)14(16)17-13/h10-13H,1,4-8H2,2-3H3/t10?,11-,12+,13-,15-/m1/s1 |
| InChIKey | YYJRTJYCOMIDIC-CBPAIQIRSA-N |
| XLogP | 3.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | 373 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|