C13H17N2S+ — CID 4745283
4-[4-(2-methylpropyl)phenyl]-1,3-thiazol-3-ium-2-amine (PubChem CID 4745283) has the molecular formula C13H17N2S+ and a molecular weight of 233.36 g/mol. Its IUPAC name is 4-[4-(2-methylpropyl)phenyl]-1,3-thiazol-3-ium-2-amine.
| Compound Name | 4-[4-(2-methylpropyl)phenyl]-1,3-thiazol-3-ium-2-amine |
|---|---|
| PubChem CID | 4745283 |
| Molecular Formula | C13H17N2S+ |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 4-[4-(2-methylpropyl)phenyl]-1,3-thiazol-3-ium-2-amine |
| SMILES | CC(C)Cc1ccc(-c2csc(N)[nH+]2)cc1 |
| InChI | InChI=1S/C13H16N2S/c1-9(2)7-10-3-5-11(6-4-10)12-8-16-13(14)15-12/h3-6,8-9H,7H2,1-2H3,(H2,14,15)/p+1 |
| InChIKey | QHFXFYBCBXWOGR-UHFFFAOYSA-O |
| XLogP | 3.01 |
| TPSA | 40.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |