C12H16N4O3S — CID 47453428
3-(2,5-dioxoimidazolidin-4-yl)-N-methyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]propanamide (PubChem CID 47453428) has the molecular formula C12H16N4O3S and a molecular weight of 296.35 g/mol. Its IUPAC name is 3-(2,5-dioxoimidazolidin-4-yl)-N-methyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]propanamide.
| Compound Name | 3-(2,5-dioxoimidazolidin-4-yl)-N-methyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]propanamide |
|---|---|
| PubChem CID | 47453428 |
| Molecular Formula | C12H16N4O3S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 3-(2,5-dioxoimidazolidin-4-yl)-N-methyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]propanamide |
| SMILES | Cc1nc(CN(C)C(=O)CCC2NC(=O)NC2=O)cs1 |
| InChI | InChI=1S/C12H16N4O3S/c1-7-13-8(6-20-7)5-16(2)10(17)4-3-9-11(18)15-12(19)14-9/h6,9H,3-5H2,1-2H3,(H2,14,15,18,19) |
| InChIKey | BFSRLRXXOUSWKH-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|