C13H10FN3O2 — CID 47460385
5-N-(3-fluorophenyl)pyridine-2,5-dicarboxamide (PubChem CID 47460385) has the molecular formula C13H10FN3O2 and a molecular weight of 259.24 g/mol. Its IUPAC name is 5-N-(3-fluorophenyl)pyridine-2,5-dicarboxamide.
| Compound Name | 5-N-(3-fluorophenyl)pyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 47460385 |
| Molecular Formula | C13H10FN3O2 |
| Molecular Weight | 259.24 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 5-N-(3-fluorophenyl)pyridine-2,5-dicarboxamide |
| SMILES | NC(=O)c1ccc(C(=O)Nc2cccc(F)c2)cn1 |
| InChI | InChI=1S/C13H10FN3O2/c14-9-2-1-3-10(6-9)17-13(19)8-4-5-11(12(15)18)16-7-8/h1-7H,(H2,15,18)(H,17,19) |
| InChIKey | KHTQZSDHDVCMNL-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |