C20H18N5O+ — CID 4746281
6-amino-3-methyl-1-(4-methylphenyl)-4-pyridin-1-ium-4-yl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile (PubChem CID 4746281) has the molecular formula C20H18N5O+ and a molecular weight of 344.40 g/mol. Its IUPAC name is 6-amino-3-methyl-1-(4-methylphenyl)-4-pyridin-1-ium-4-yl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile.
| Compound Name | 6-amino-3-methyl-1-(4-methylphenyl)-4-pyridin-1-ium-4-yl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 4746281 |
| Molecular Formula | C20H18N5O+ |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 6-amino-3-methyl-1-(4-methylphenyl)-4-pyridin-1-ium-4-yl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile |
| SMILES | Cc1ccc(-n2nc(C)c3c2OC(N)=C(C#N)C3c2cc[nH+]cc2)cc1 |
| InChI | InChI=1S/C20H17N5O/c1-12-3-5-15(6-4-12)25-20-17(13(2)24-25)18(14-7-9-23-10-8-14)16(11-21)19(22)26-20/h3-10,18H,22H2,1-2H3/p+1 |
| InChIKey | GYFKSPFETMFMKC-UHFFFAOYSA-O |
| XLogP | 2.52 |
| TPSA | 91.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_B(9)', 'substructure': 'N/A'} |
|---|