About N-(cyanomethyl)-2-(3,5-diiodo-4-oxo-1-pyridinyl)-N-ethylacetamide
N-(cyanomethyl)-2-(3,5-diiodo-4-oxo-1-pyridinyl)-N-ethylacetamide (PubChem CID 47462998) has the molecular formula C11H11I2N3O2
and a molecular weight of 471.04 g/mol. Its IUPAC name is N-(cyanomethyl)-2-(3,5-diiodo-4-oxo-1-pyridinyl)-N-ethylacetamide.
Molecular Properties
| Compound Name | N-(cyanomethyl)-2-(3,5-diiodo-4-oxo-1-pyridinyl)-N-ethylacetamide |
| PubChem CID | 47462998 |
| Molecular Formula | C11H11I2N3O2 |
| Molecular Weight | 471.04 g/mol |
| Exact Mass | 470.89 |
| IUPAC Name | N-(cyanomethyl)-2-(3,5-diiodo-4-oxo-1-pyridinyl)-N-ethylacetamide |
| SMILES | CCN(CC#N)C(=O)Cn1cc(I)c(=O)c(I)c1 |
| InChI | InChI=1S/C11H11I2N3O2/c1-2-16(4-3-14)10(17)7-15-5-8(12)11(18)9(13)6-15/h5-6H,2,4,7H2,1H3 |
| InChIKey | LCXDLTGNSHENKT-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 66.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 471.04 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N-(cyanomethyl)-2-(3,5-diiodo-4-oxo-1-pyridinyl)-N-ethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyanomethyl)-2-(3,5-diiodo-4-oxo-1-pyridinyl)-N-ethylacetamide?
The IUPAC name of N-(cyanomethyl)-2-(3,5-diiodo-4-oxo-1-pyridinyl)-N-ethylacetamide (CID 47462998) is N-(cyanomethyl)-2-(3,5-diiodo-4-oxo-1-pyridinyl)-N-ethylacetamide.
What is the SMILES notation for N-(cyanomethyl)-2-(3,5-diiodo-4-oxo-1-pyridinyl)-N-ethylacetamide?
The canonical SMILES for N-(cyanomethyl)-2-(3,5-diiodo-4-oxo-1-pyridinyl)-N-ethylacetamide is CCN(CC#N)C(=O)Cn1cc(I)c(=O)c(I)c1.
What is the InChIKey of N-(cyanomethyl)-2-(3,5-diiodo-4-oxo-1-pyridinyl)-N-ethylacetamide?
The InChIKey is LCXDLTGNSHENKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11I2N3O2/c1-2-16(4-3-14)10(17)7-15-5-8(12)11(18)9(13)6-15/h5-6H,2,4,7H2,1H3.
What are the key properties of N-(cyanomethyl)-2-(3,5-diiodo-4-oxo-1-pyridinyl)-N-ethylacetamide?
N-(cyanomethyl)-2-(3,5-diiodo-4-oxo-1-pyridinyl)-N-ethylacetamide has a molecular weight of 471.04 g/mol, XLogP of 1.43, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyanomethyl)-2-(3,5-diiodo-4-oxo-1-pyridinyl)-N-ethylacetamide is sourced from PubChem (CID 47462998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).