C16H17NO5 — CID 4746352
6-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamoyl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 4746352) has the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. Its IUPAC name is 6-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamoyl)cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamoyl)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 4746352 |
| Molecular Formula | C16H17NO5 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 6-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamoyl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)C1CC=CCC1C(=O)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C16H17NO5/c18-15(11-3-1-2-4-12(11)16(19)20)17-10-5-6-13-14(9-10)22-8-7-21-13/h1-2,5-6,9,11-12H,3-4,7-8H2,(H,17,18)(H,19,20) |
| InChIKey | OGMORJZWMGMBFU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|