C14H10N2O4S — CID 4746431
5-[(6-methoxy-4-oxochromen-3-yl)methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 4746431) has the molecular formula C14H10N2O4S and a molecular weight of 302.31 g/mol. Its IUPAC name is 5-[(6-methoxy-4-oxochromen-3-yl)methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 5-[(6-methoxy-4-oxochromen-3-yl)methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 4746431 |
| Molecular Formula | C14H10N2O4S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 5-[(6-methoxy-4-oxochromen-3-yl)methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | COc1ccc2occ(C=C3NC(=S)NC3=O)c(=O)c2c1 |
| InChI | InChI=1S/C14H10N2O4S/c1-19-8-2-3-11-9(5-8)12(17)7(6-20-11)4-10-13(18)16-14(21)15-10/h2-6H,1H3,(H2,15,16,18,21) |
| InChIKey | AEPQHDASDOBSAW-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|