About 1-cyclohexyl-3-(4,5-dimethyl-1,3-oxazol-2-yl)-1-prop-2-ynylurea
1-cyclohexyl-3-(4,5-dimethyl-1,3-oxazol-2-yl)-1-prop-2-ynylurea (PubChem CID 47465250) has the molecular formula C15H21N3O2
and a molecular weight of 275.35 g/mol. Its IUPAC name is 1-cyclohexyl-3-(4,5-dimethyl-1,3-oxazol-2-yl)-1-prop-2-ynylurea.
Molecular Properties
| Compound Name | 1-cyclohexyl-3-(4,5-dimethyl-1,3-oxazol-2-yl)-1-prop-2-ynylurea |
| PubChem CID | 47465250 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 1-cyclohexyl-3-(4,5-dimethyl-1,3-oxazol-2-yl)-1-prop-2-ynylurea |
| SMILES | C#CCN(C(=O)Nc1nc(C)c(C)o1)C1CCCCC1 |
| InChI | InChI=1S/C15H21N3O2/c1-4-10-18(13-8-6-5-7-9-13)15(19)17-14-16-11(2)12(3)20-14/h1,13H,5-10H2,2-3H3,(H,16,17,19) |
| InChIKey | OHKVFDHDMHAACX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyl-3-(4,5-dimethyl-1,3-oxazol-2-yl)-1-prop-2-ynylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-3-(4,5-dimethyl-1,3-oxazol-2-yl)-1-prop-2-ynylurea?
The IUPAC name of 1-cyclohexyl-3-(4,5-dimethyl-1,3-oxazol-2-yl)-1-prop-2-ynylurea (CID 47465250) is 1-cyclohexyl-3-(4,5-dimethyl-1,3-oxazol-2-yl)-1-prop-2-ynylurea.
What is the SMILES notation for 1-cyclohexyl-3-(4,5-dimethyl-1,3-oxazol-2-yl)-1-prop-2-ynylurea?
The canonical SMILES for 1-cyclohexyl-3-(4,5-dimethyl-1,3-oxazol-2-yl)-1-prop-2-ynylurea is C#CCN(C(=O)Nc1nc(C)c(C)o1)C1CCCCC1.
What is the InChIKey of 1-cyclohexyl-3-(4,5-dimethyl-1,3-oxazol-2-yl)-1-prop-2-ynylurea?
The InChIKey is OHKVFDHDMHAACX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O2/c1-4-10-18(13-8-6-5-7-9-13)15(19)17-14-16-11(2)12(3)20-14/h1,13H,5-10H2,2-3H3,(H,16,17,19).
What are the key properties of 1-cyclohexyl-3-(4,5-dimethyl-1,3-oxazol-2-yl)-1-prop-2-ynylurea?
1-cyclohexyl-3-(4,5-dimethyl-1,3-oxazol-2-yl)-1-prop-2-ynylurea has a molecular weight of 275.35 g/mol, XLogP of 3.09, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-3-(4,5-dimethyl-1,3-oxazol-2-yl)-1-prop-2-ynylurea is sourced from PubChem (CID 47465250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).