C15H21BrN2O2 — CID 47467269
1-[2-(4-bromophenoxy)ethyl]-3-cyclohexylurea (PubChem CID 47467269) has the molecular formula C15H21BrN2O2 and a molecular weight of 341.25 g/mol. Its IUPAC name is 1-[2-(4-bromophenoxy)ethyl]-3-cyclohexylurea.
| Compound Name | 1-[2-(4-bromophenoxy)ethyl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 47467269 |
| Molecular Formula | C15H21BrN2O2 |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 1-[2-(4-bromophenoxy)ethyl]-3-cyclohexylurea |
| SMILES | O=C(NCCOc1ccc(Br)cc1)NC1CCCCC1 |
| InChI | InChI=1S/C15H21BrN2O2/c16-12-6-8-14(9-7-12)20-11-10-17-15(19)18-13-4-2-1-3-5-13/h6-9,13H,1-5,10-11H2,(H2,17,18,19) |
| InChIKey | HHPZFSCENAFHLI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|