About 6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid
6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid (PubChem CID 4746853) has the molecular formula C10H12O2S
and a molecular weight of 196.27 g/mol. Its IUPAC name is 6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid.
Analyze 6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid?
The IUPAC name of 6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid (CID 4746853) is 6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid.
What is the SMILES notation for 6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid?
The canonical SMILES for 6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid is CC1CCc2c(C(=O)O)csc2C1.
What is the InChIKey of 6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid?
The InChIKey is SPYKIQRRGBUFSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2S/c1-6-2-3-7-8(10(11)12)5-13-9(7)4-6/h5-6H,2-4H2,1H3,(H,11,12).
What are the key properties of 6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid?
6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid has a molecular weight of 196.27 g/mol, XLogP of 2.57, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid is sourced from PubChem (CID 4746853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).