C26H33N4O3+3 — CID 4747674
6-ethyl-7-hydroxy-2-methyl-3-(3-methyl-1H-benzimidazol-3-ium-2-yl)-8-[(4-methylpiperazine-1,4-diium-1-yl)methyl]chromen-4-one (PubChem CID 4747674) has the molecular formula C26H33N4O3+3 and a molecular weight of 449.58 g/mol. Its IUPAC name is 6-ethyl-7-hydroxy-2-methyl-3-(3-methyl-1H-benzimidazol-3-ium-2-yl)-8-[(4-methylpiperazine-1,4-diium-1-yl)methyl]chromen-4-one.
| Compound Name | 6-ethyl-7-hydroxy-2-methyl-3-(3-methyl-1H-benzimidazol-3-ium-2-yl)-8-[(4-methylpiperazine-1,4-diium-1-yl)methyl]chromen-4-one |
|---|---|
| PubChem CID | 4747674 |
| Molecular Formula | C26H33N4O3+3 |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | 6-ethyl-7-hydroxy-2-methyl-3-(3-methyl-1H-benzimidazol-3-ium-2-yl)-8-[(4-methylpiperazine-1,4-diium-1-yl)methyl]chromen-4-one |
| SMILES | CCc1cc2c(=O)c(-c3[nH]c4ccccc4[n+]3C)c(C)oc2c(C[NH+]2CC[NH+](C)CC2)c1O |
| InChI | InChI=1S/C26H30N4O3/c1-5-17-14-18-24(32)22(26-27-20-8-6-7-9-21(20)29(26)4)16(2)33-25(18)19(23(17)31)15-30-12-10-28(3)11-13-30/h6-9,14H,5,10-13,15H2,1-4H3,(H,31,32)/p+3 |
| InChIKey | UPNZOVNMNNYHSA-UHFFFAOYSA-Q |
| XLogP | 0.26 |
| TPSA | 78.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|