C18H13BrNO2- — CID 4747845
6-bromo-2-(2,4-dimethylphenyl)quinoline-4-carboxylate (PubChem CID 4747845) has the molecular formula C18H13BrNO2- and a molecular weight of 355.21 g/mol. Its IUPAC name is 6-bromo-2-(2,4-dimethylphenyl)quinoline-4-carboxylate.
| Compound Name | 6-bromo-2-(2,4-dimethylphenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 4747845 |
| Molecular Formula | C18H13BrNO2- |
| Molecular Weight | 355.21 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | 6-bromo-2-(2,4-dimethylphenyl)quinoline-4-carboxylate |
| SMILES | Cc1ccc(-c2cc(C(=O)[O-])c3cc(Br)ccc3n2)c(C)c1 |
| InChI | InChI=1S/C18H14BrNO2/c1-10-3-5-13(11(2)7-10)17-9-15(18(21)22)14-8-12(19)4-6-16(14)20-17/h3-9H,1-2H3,(H,21,22)/p-1 |
| InChIKey | WGIPFPVIJZUIFT-UHFFFAOYSA-M |
| XLogP | 3.64 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.21 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |