C12H12ClIN2O2 — CID 47478589
4-chloro-3-iodo-N-(2-oxopiperidin-3-yl)benzamide (PubChem CID 47478589) has the molecular formula C12H12ClIN2O2 and a molecular weight of 378.60 g/mol. Its IUPAC name is 4-chloro-3-iodo-N-(2-oxopiperidin-3-yl)benzamide.
| Compound Name | 4-chloro-3-iodo-N-(2-oxopiperidin-3-yl)benzamide |
|---|---|
| PubChem CID | 47478589 |
| Molecular Formula | C12H12ClIN2O2 |
| Molecular Weight | 378.60 g/mol |
| Exact Mass | 377.96 |
| IUPAC Name | 4-chloro-3-iodo-N-(2-oxopiperidin-3-yl)benzamide |
| SMILES | O=C(NC1CCCNC1=O)c1ccc(Cl)c(I)c1 |
| InChI | InChI=1S/C12H12ClIN2O2/c13-8-4-3-7(6-9(8)14)11(17)16-10-2-1-5-15-12(10)18/h3-4,6,10H,1-2,5H2,(H,15,18)(H,16,17) |
| InChIKey | QVFDBVXCVARZGD-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.60 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|