C15H29N3O2 — CID 47481518
1-(2-methylpentan-3-yl)-3-(1-oxo-1-piperidin-1-ylpropan-2-yl)urea (PubChem CID 47481518) has the molecular formula C15H29N3O2 and a molecular weight of 283.42 g/mol. Its IUPAC name is 1-(2-methylpentan-3-yl)-3-(1-oxo-1-piperidin-1-ylpropan-2-yl)urea.
| Compound Name | 1-(2-methylpentan-3-yl)-3-(1-oxo-1-piperidin-1-ylpropan-2-yl)urea |
|---|---|
| PubChem CID | 47481518 |
| Molecular Formula | C15H29N3O2 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | 1-(2-methylpentan-3-yl)-3-(1-oxo-1-piperidin-1-ylpropan-2-yl)urea |
| SMILES | CCC(NC(=O)NC(C)C(=O)N1CCCCC1)C(C)C |
| InChI | InChI=1S/C15H29N3O2/c1-5-13(11(2)3)17-15(20)16-12(4)14(19)18-9-7-6-8-10-18/h11-13H,5-10H2,1-4H3,(H2,16,17,20) |
| InChIKey | OQDAPPCFXSHGAH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |