C17H12ClN5O3 — CID 4748531
N-[[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methylideneamino]-4-nitrobenzamide (PubChem CID 4748531) has the molecular formula C17H12ClN5O3 and a molecular weight of 369.77 g/mol. Its IUPAC name is N-[[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methylideneamino]-4-nitrobenzamide.
| Compound Name | N-[[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methylideneamino]-4-nitrobenzamide |
|---|---|
| PubChem CID | 4748531 |
| Molecular Formula | C17H12ClN5O3 |
| Molecular Weight | 369.77 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | N-[[5-(4-chlorophenyl)-1H-pyrazol-4-yl]methylideneamino]-4-nitrobenzamide |
| SMILES | O=C(NN=Cc1cn[nH]c1-c1ccc(Cl)cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H12ClN5O3/c18-14-5-1-11(2-6-14)16-13(9-19-21-16)10-20-22-17(24)12-3-7-15(8-4-12)23(25)26/h1-10H,(H,19,21)(H,22,24) |
| InChIKey | YJERBYUDFVAEMY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 113.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.77 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|