About 1-[1-(1,5-dimethylpyrazol-4-yl)ethyl]-3-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]urea
1-[1-(1,5-dimethylpyrazol-4-yl)ethyl]-3-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]urea (PubChem CID 47492266) has the molecular formula C14H16F3N5O2
and a molecular weight of 343.31 g/mol. Its IUPAC name is 1-[1-(1,5-dimethylpyrazol-4-yl)ethyl]-3-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]urea.
Molecular Properties
| Compound Name | 1-[1-(1,5-dimethylpyrazol-4-yl)ethyl]-3-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]urea |
| PubChem CID | 47492266 |
| Molecular Formula | C14H16F3N5O2 |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 1-[1-(1,5-dimethylpyrazol-4-yl)ethyl]-3-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]urea |
| SMILES | Cc1c(C(C)NC(=O)Nc2cc(C(F)(F)F)c[nH]c2=O)cnn1C |
| InChI | InChI=1S/C14H16F3N5O2/c1-7(10-6-19-22(3)8(10)2)20-13(24)21-11-4-9(14(15,16)17)5-18-12(11)23/h4-7H,1-3H3,(H,18,23)(H2,20,21,24) |
| InChIKey | LYHYWFNHNZHEQV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[1-(1,5-dimethylpyrazol-4-yl)ethyl]-3-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(1,5-dimethylpyrazol-4-yl)ethyl]-3-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]urea?
The IUPAC name of 1-[1-(1,5-dimethylpyrazol-4-yl)ethyl]-3-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]urea (CID 47492266) is 1-[1-(1,5-dimethylpyrazol-4-yl)ethyl]-3-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]urea.
What is the SMILES notation for 1-[1-(1,5-dimethylpyrazol-4-yl)ethyl]-3-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]urea?
The canonical SMILES for 1-[1-(1,5-dimethylpyrazol-4-yl)ethyl]-3-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]urea is Cc1c(C(C)NC(=O)Nc2cc(C(F)(F)F)c[nH]c2=O)cnn1C.
What is the InChIKey of 1-[1-(1,5-dimethylpyrazol-4-yl)ethyl]-3-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]urea?
The InChIKey is LYHYWFNHNZHEQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16F3N5O2/c1-7(10-6-19-22(3)8(10)2)20-13(24)21-11-4-9(14(15,16)17)5-18-12(11)23/h4-7H,1-3H3,(H,18,23)(H2,20,21,24).
What are the key properties of 1-[1-(1,5-dimethylpyrazol-4-yl)ethyl]-3-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]urea?
1-[1-(1,5-dimethylpyrazol-4-yl)ethyl]-3-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]urea has a molecular weight of 343.31 g/mol, XLogP of 2.32, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(1,5-dimethylpyrazol-4-yl)ethyl]-3-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]urea is sourced from PubChem (CID 47492266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).