About ethyl 2-[(5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carbonyl)amino]propanoate
ethyl 2-[(5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carbonyl)amino]propanoate (PubChem CID 47494468) has the molecular formula C14H18N4O3
and a molecular weight of 290.32 g/mol. Its IUPAC name is ethyl 2-[(5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carbonyl)amino]propanoate.
Molecular Properties
| Compound Name | ethyl 2-[(5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carbonyl)amino]propanoate |
| PubChem CID | 47494468 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | ethyl 2-[(5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carbonyl)amino]propanoate |
| SMILES | CCOC(=O)C(C)NC(=O)c1cnn2c(C)cc(C)nc12 |
| InChI | InChI=1S/C14H18N4O3/c1-5-21-14(20)10(4)17-13(19)11-7-15-18-9(3)6-8(2)16-12(11)18/h6-7,10H,5H2,1-4H3,(H,17,19) |
| InChIKey | SSUVMLCEGBSKBV-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-[(5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carbonyl)amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carbonyl)amino]propanoate?
The IUPAC name of ethyl 2-[(5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carbonyl)amino]propanoate (CID 47494468) is ethyl 2-[(5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carbonyl)amino]propanoate.
What is the SMILES notation for ethyl 2-[(5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carbonyl)amino]propanoate?
The canonical SMILES for ethyl 2-[(5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carbonyl)amino]propanoate is CCOC(=O)C(C)NC(=O)c1cnn2c(C)cc(C)nc12.
What is the InChIKey of ethyl 2-[(5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carbonyl)amino]propanoate?
The InChIKey is SSUVMLCEGBSKBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4O3/c1-5-21-14(20)10(4)17-13(19)11-7-15-18-9(3)6-8(2)16-12(11)18/h6-7,10H,5H2,1-4H3,(H,17,19).
What are the key properties of ethyl 2-[(5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carbonyl)amino]propanoate?
ethyl 2-[(5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carbonyl)amino]propanoate has a molecular weight of 290.32 g/mol, XLogP of 1.03, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carbonyl)amino]propanoate is sourced from PubChem (CID 47494468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).