C25H28N3O2S+ — CID 4749979
2,7,7-trimethyl-4-(4-methylsulfanylphenyl)-5-oxo-N-pyridin-1-ium-2-yl-1,4,6,8-tetrahydroquinoline-3-carboxamide (PubChem CID 4749979) has the molecular formula C25H28N3O2S+ and a molecular weight of 434.59 g/mol. Its IUPAC name is 2,7,7-trimethyl-4-(4-methylsulfanylphenyl)-5-oxo-N-pyridin-1-ium-2-yl-1,4,6,8-tetrahydroquinoline-3-carboxamide.
| Compound Name | 2,7,7-trimethyl-4-(4-methylsulfanylphenyl)-5-oxo-N-pyridin-1-ium-2-yl-1,4,6,8-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 4749979 |
| Molecular Formula | C25H28N3O2S+ |
| Molecular Weight | 434.59 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 2,7,7-trimethyl-4-(4-methylsulfanylphenyl)-5-oxo-N-pyridin-1-ium-2-yl-1,4,6,8-tetrahydroquinoline-3-carboxamide |
| SMILES | CSc1ccc(C2C(C(=O)Nc3cccc[nH+]3)=C(C)NC3=C2C(=O)CC(C)(C)C3)cc1 |
| InChI | InChI=1S/C25H27N3O2S/c1-15-21(24(30)28-20-7-5-6-12-26-20)22(16-8-10-17(31-4)11-9-16)23-18(27-15)13-25(2,3)14-19(23)29/h5-12,22,27H,13-14H2,1-4H3,(H,26,28,30)/p+1 |
| InChIKey | KOCLNSLPPORYAS-UHFFFAOYSA-O |
| XLogP | 4.47 |
| TPSA | 72.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.59 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |